C14H7F6N3O4 — CID 22763905
but-2-ynyl 4-nitro-2,6-bis(trifluoromethyl)benzimidazole-1-carboxylate (PubChem CID 22763905) has the molecular formula C14H7F6N3O4 and a molecular weight of 395.22 g/mol. Its IUPAC name is but-2-ynyl 4-nitro-2,6-bis(trifluoromethyl)benzimidazole-1-carboxylate.
| Compound Name | but-2-ynyl 4-nitro-2,6-bis(trifluoromethyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 22763905 |
| Molecular Formula | C14H7F6N3O4 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | but-2-ynyl 4-nitro-2,6-bis(trifluoromethyl)benzimidazole-1-carboxylate |
| SMILES | CC#CCOC(=O)n1c(C(F)(F)F)nc2c([N+](=O)[O-])cc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H7F6N3O4/c1-2-3-4-27-12(24)22-8-5-7(13(15,16)17)6-9(23(25)26)10(8)21-11(22)14(18,19)20/h5-6H,4H2,1H3 |
| InChIKey | BXMAKIJRTJNALF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|