C14H9F6N3O4 — CID 88809621
2-but-2-ynyl-4-nitro-2,6-bis(trifluoromethyl)-3H-benzimidazole-1-carboxylic acid (PubChem CID 88809621) has the molecular formula C14H9F6N3O4 and a molecular weight of 397.23 g/mol. Its IUPAC name is 2-but-2-ynyl-4-nitro-2,6-bis(trifluoromethyl)-3H-benzimidazole-1-carboxylic acid.
| Compound Name | 2-but-2-ynyl-4-nitro-2,6-bis(trifluoromethyl)-3H-benzimidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 88809621 |
| Molecular Formula | C14H9F6N3O4 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-but-2-ynyl-4-nitro-2,6-bis(trifluoromethyl)-3H-benzimidazole-1-carboxylic acid |
| SMILES | CC#CCC1(C(F)(F)F)Nc2c(cc(C(F)(F)F)cc2[N+](=O)[O-])N1C(=O)O |
| InChI | InChI=1S/C14H9F6N3O4/c1-2-3-4-12(14(18,19)20)21-10-8(22(12)11(24)25)5-7(13(15,16)17)6-9(10)23(26)27/h5-6,21H,4H2,1H3,(H,24,25) |
| InChIKey | OHRPTBWWYDYJHB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|