C18H12F6N4O2S — CID 22908739
N-ethyl-4-nitro-N-phenyl-2,6-bis(trifluoromethyl)benzimidazole-1-carbothioamide (PubChem CID 22908739) has the molecular formula C18H12F6N4O2S and a molecular weight of 462.38 g/mol. Its IUPAC name is N-ethyl-4-nitro-N-phenyl-2,6-bis(trifluoromethyl)benzimidazole-1-carbothioamide.
| Compound Name | N-ethyl-4-nitro-N-phenyl-2,6-bis(trifluoromethyl)benzimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 22908739 |
| Molecular Formula | C18H12F6N4O2S |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-ethyl-4-nitro-N-phenyl-2,6-bis(trifluoromethyl)benzimidazole-1-carbothioamide |
| SMILES | CCN(C(=S)n1c(C(F)(F)F)nc2c([N+](=O)[O-])cc(C(F)(F)F)cc21)c1ccccc1 |
| InChI | InChI=1S/C18H12F6N4O2S/c1-2-26(11-6-4-3-5-7-11)16(31)27-12-8-10(17(19,20)21)9-13(28(29)30)14(12)25-15(27)18(22,23)24/h3-9H,2H2,1H3 |
| InChIKey | QJZUBEMRFNCXJD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|