C14H10F7N3O4 — CID 22908755
propan-2-yl 4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)benzimidazole-1-carboxylate (PubChem CID 22908755) has the molecular formula C14H10F7N3O4 and a molecular weight of 417.24 g/mol. Its IUPAC name is propan-2-yl 4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)benzimidazole-1-carboxylate.
| Compound Name | propan-2-yl 4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 22908755 |
| Molecular Formula | C14H10F7N3O4 |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | propan-2-yl 4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)benzimidazole-1-carboxylate |
| SMILES | CC(C)OC(=O)n1c(C(F)(F)C(F)F)nc2c([N+](=O)[O-])cc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H10F7N3O4/c1-5(2)28-12(25)23-7-3-6(14(19,20)21)4-8(24(26)27)9(7)22-11(23)13(17,18)10(15)16/h3-5,10H,1-2H3 |
| InChIKey | KZBLZIAMMOTEIG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|