C9H5F3N4O5 — CID 21428399
1-methoxy-4,6-dinitro-2-(trifluoromethyl)benzimidazole (PubChem CID 21428399) has the molecular formula C9H5F3N4O5 and a molecular weight of 306.16 g/mol. Its IUPAC name is 1-methoxy-4,6-dinitro-2-(trifluoromethyl)benzimidazole.
| Compound Name | 1-methoxy-4,6-dinitro-2-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 21428399 |
| Molecular Formula | C9H5F3N4O5 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-methoxy-4,6-dinitro-2-(trifluoromethyl)benzimidazole |
| SMILES | COn1c(C(F)(F)F)nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H5F3N4O5/c1-21-14-5-2-4(15(17)18)3-6(16(19)20)7(5)13-8(14)9(10,11)12/h2-3H,1H3 |
| InChIKey | LXAYXZNUWCPCGZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 113.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|