C18H12F6N4O3S — CID 54226388
N-ethyl-6-nitro-N-phenyl-4-sulfanyl-2,5-bis(trifluoromethyl)benzimidazole-1-carboxamide (PubChem CID 54226388) has the molecular formula C18H12F6N4O3S and a molecular weight of 478.37 g/mol. Its IUPAC name is N-ethyl-6-nitro-N-phenyl-4-sulfanyl-2,5-bis(trifluoromethyl)benzimidazole-1-carboxamide.
| Compound Name | N-ethyl-6-nitro-N-phenyl-4-sulfanyl-2,5-bis(trifluoromethyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 54226388 |
| Molecular Formula | C18H12F6N4O3S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-ethyl-6-nitro-N-phenyl-4-sulfanyl-2,5-bis(trifluoromethyl)benzimidazole-1-carboxamide |
| SMILES | CCN(C(=O)n1c(C(F)(F)F)nc2c(S)c(C(F)(F)F)c([N+](=O)[O-])cc21)c1ccccc1 |
| InChI | InChI=1S/C18H12F6N4O3S/c1-2-26(9-6-4-3-5-7-9)16(29)27-11-8-10(28(30)31)12(17(19,20)21)14(32)13(11)25-15(27)18(22,23)24/h3-8,32H,2H2,1H3 |
| InChIKey | QGDLRNKHSARWRD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|