C21H20F3N5O2 — CID 52937112
N-[(3-nitrophenyl)methyl]-3-piperazin-1-yl-7-(trifluoromethyl)quinolin-5-amine (PubChem CID 52937112) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-3-piperazin-1-yl-7-(trifluoromethyl)quinolin-5-amine.
| Compound Name | N-[(3-nitrophenyl)methyl]-3-piperazin-1-yl-7-(trifluoromethyl)quinolin-5-amine |
|---|---|
| PubChem CID | 52937112 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-3-piperazin-1-yl-7-(trifluoromethyl)quinolin-5-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2cc(C(F)(F)F)cc3ncc(N4CCNCC4)cc23)c1 |
| InChI | InChI=1S/C21H20F3N5O2/c22-21(23,24)15-9-19(26-12-14-2-1-3-16(8-14)29(30)31)18-11-17(13-27-20(18)10-15)28-6-4-25-5-7-28/h1-3,8-11,13,25-26H,4-7,12H2 |
| InChIKey | UVLXHPUXQLJCPN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|