C25H26F3N5O4 — CID 52937325
ethyl 2-[4-[5-[(3-nitrophenyl)methylamino]-7-(trifluoromethyl)quinolin-3-yl]piperazin-1-yl]acetate (PubChem CID 52937325) has the molecular formula C25H26F3N5O4 and a molecular weight of 517.51 g/mol. Its IUPAC name is ethyl 2-[4-[5-[(3-nitrophenyl)methylamino]-7-(trifluoromethyl)quinolin-3-yl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[5-[(3-nitrophenyl)methylamino]-7-(trifluoromethyl)quinolin-3-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 52937325 |
| Molecular Formula | C25H26F3N5O4 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | ethyl 2-[4-[5-[(3-nitrophenyl)methylamino]-7-(trifluoromethyl)quinolin-3-yl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2cnc3cc(C(F)(F)F)cc(NCc4cccc([N+](=O)[O-])c4)c3c2)CC1 |
| InChI | InChI=1S/C25H26F3N5O4/c1-2-37-24(34)16-31-6-8-32(9-7-31)20-13-21-22(11-18(25(26,27)28)12-23(21)30-15-20)29-14-17-4-3-5-19(10-17)33(35)36/h3-5,10-13,15,29H,2,6-9,14,16H2,1H3 |
| InChIKey | GQOXYCLMMCEMBJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|