C11H14N4O2 — CID 110916811
N-[(3-nitrophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 110916811) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[(3-nitrophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 110916811 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cccc(CNC2=NCCCN2)c1 |
| InChI | InChI=1S/C11H14N4O2/c16-15(17)10-4-1-3-9(7-10)8-14-11-12-5-2-6-13-11/h1,3-4,7H,2,5-6,8H2,(H2,12,13,14) |
| InChIKey | PPENEYXHQBRYHJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|