C11H15ClIN3 — CID 110913998
N-[(3-chlorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110913998) has the molecular formula C11H15ClIN3 and a molecular weight of 351.62 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(3-chlorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110913998 |
| Molecular Formula | C11H15ClIN3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Clc1cccc(CNC2=NCCCN2)c1.I |
| InChI | InChI=1S/C11H14ClN3.HI/c12-10-4-1-3-9(7-10)8-15-11-13-5-2-6-14-11;/h1,3-4,7H,2,5-6,8H2,(H2,13,14,15);1H |
| InChIKey | NPCBAORXEUUKJC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|