C13H21IN4 — CID 75480286
N-[[4-(dimethylamino)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 75480286) has the molecular formula C13H21IN4 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 75480286 |
| Molecular Formula | C13H21IN4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CN(C)c1ccc(CNC2=NCCCN2)cc1.I |
| InChI | InChI=1S/C13H20N4.HI/c1-17(2)12-6-4-11(5-7-12)10-16-13-14-8-3-9-15-13;/h4-7H,3,8-10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | MLSYSTPWYBQCQR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|