C17H27IN4 — CID 111109738
N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 111109738) has the molecular formula C17H27IN4 and a molecular weight of 414.34 g/mol. Its IUPAC name is N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 111109738 |
| Molecular Formula | C17H27IN4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CC1CCN(c2ccc(CNC3=NCCCN3)cc2)CC1.I |
| InChI | InChI=1S/C17H26N4.HI/c1-14-7-11-21(12-8-14)16-5-3-15(4-6-16)13-20-17-18-9-2-10-19-17;/h3-6,14H,2,7-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | DWIIRJRXFYETKP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|