C11H15ClN4 — CID 125422336
N-[(6-chloro-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine (PubChem CID 125422336) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine |
|---|---|
| PubChem CID | 125422336 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine |
| SMILES | Clc1ccc(CNC2=NCCCCN2)cn1 |
| InChI | InChI=1S/C11H15ClN4/c12-10-4-3-9(7-15-10)8-16-11-13-5-1-2-6-14-11/h3-4,7H,1-2,5-6,8H2,(H2,13,14,16) |
| InChIKey | IPQAQOHMWQSZNF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|