C18H23IN4O3 — CID 119112774
N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 119112774) has the molecular formula C18H23IN4O3 and a molecular weight of 470.31 g/mol. Its IUPAC name is N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 119112774 |
| Molecular Formula | C18H23IN4O3 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[[6-(2,6-dimethoxyphenoxy)-3-pyridinyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | COc1cccc(OC)c1Oc1ccc(CNC2=NCCCN2)cn1.I |
| InChI | InChI=1S/C18H22N4O3.HI/c1-23-14-5-3-6-15(24-2)17(14)25-16-8-7-13(11-21-16)12-22-18-19-9-4-10-20-18;/h3,5-8,11H,4,9-10,12H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | UUEFYXHFRLHOHZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|