C13H17F3IN3O2 — CID 120967403
N-[[2-methoxy-6-(trifluoromethoxy)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 120967403) has the molecular formula C13H17F3IN3O2 and a molecular weight of 431.20 g/mol. Its IUPAC name is N-[[2-methoxy-6-(trifluoromethoxy)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[2-methoxy-6-(trifluoromethoxy)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120967403 |
| Molecular Formula | C13H17F3IN3O2 |
| Molecular Weight | 431.20 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[[2-methoxy-6-(trifluoromethoxy)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | COc1cccc(OC(F)(F)F)c1CNC1=NCCCN1.I |
| InChI | InChI=1S/C13H16F3N3O2.HI/c1-20-10-4-2-5-11(21-13(14,15)16)9(10)8-19-12-17-6-3-7-18-12;/h2,4-5H,3,6-8H2,1H3,(H2,17,18,19);1H |
| InChIKey | DOJNXMHYIPXVLZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|