C14H20IN3O3 — CID 110930085
methyl 2-methoxy-5-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzoate;hydroiodide (PubChem CID 110930085) has the molecular formula C14H20IN3O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is methyl 2-methoxy-5-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 110930085 |
| Molecular Formula | C14H20IN3O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | methyl 2-methoxy-5-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzoate;hydroiodide |
| SMILES | COC(=O)c1cc(CNC2=NCCCN2)ccc1OC.I |
| InChI | InChI=1S/C14H19N3O3.HI/c1-19-12-5-4-10(8-11(12)13(18)20-2)9-17-14-15-6-3-7-16-14;/h4-5,8H,3,6-7,9H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | RDXJEPQJYBFSQZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|