C12H16N4O — CID 119112709
3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzamide (PubChem CID 119112709) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzamide.
| Compound Name | 3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 119112709 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC2=NCCCN2)c1 |
| InChI | InChI=1S/C12H16N4O/c13-11(17)10-4-1-3-9(7-10)8-16-12-14-5-2-6-15-12/h1,3-4,7H,2,5-6,8H2,(H2,13,17)(H2,14,15,16) |
| InChIKey | XUUJILNIYFHVOM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |