C17H22IN5O2 — CID 120655362
ethyl 1-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]pyrazole-3-carboxylate;hydroiodide (PubChem CID 120655362) has the molecular formula C17H22IN5O2 and a molecular weight of 455.30 g/mol. Its IUPAC name is ethyl 1-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]pyrazole-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]pyrazole-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 120655362 |
| Molecular Formula | C17H22IN5O2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | ethyl 1-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]pyrazole-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)c1ccn(-c2cccc(CNC3=NCCCN3)c2)n1.I |
| InChI | InChI=1S/C17H21N5O2.HI/c1-2-24-16(23)15-7-10-22(21-15)14-6-3-5-13(11-14)12-20-17-18-8-4-9-19-17;/h3,5-7,10-11H,2,4,8-9,12H2,1H3,(H2,18,19,20);1H |
| InChIKey | DDHYBKCIZLKBJL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|