C20H19FN4O3 — CID 55742788
ethyl 1-[3-[(4-fluorophenyl)methylcarbamoylamino]phenyl]pyrazole-3-carboxylate (PubChem CID 55742788) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is ethyl 1-[3-[(4-fluorophenyl)methylcarbamoylamino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-[(4-fluorophenyl)methylcarbamoylamino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55742788 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 1-[3-[(4-fluorophenyl)methylcarbamoylamino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2cccc(NC(=O)NCc3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C20H19FN4O3/c1-2-28-19(26)18-10-11-25(24-18)17-5-3-4-16(12-17)23-20(27)22-13-14-6-8-15(21)9-7-14/h3-12H,2,13H2,1H3,(H2,22,23,27) |
| InChIKey | QMZOIKLHYACIPD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |