C22H22N4O4 — CID 55688446
ethyl 1-[3-[[2-[benzoyl(methyl)amino]acetyl]amino]phenyl]pyrazole-3-carboxylate (PubChem CID 55688446) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl 1-[3-[[2-[benzoyl(methyl)amino]acetyl]amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-[[2-[benzoyl(methyl)amino]acetyl]amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55688446 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | ethyl 1-[3-[[2-[benzoyl(methyl)amino]acetyl]amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2cccc(NC(=O)CN(C)C(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C22H22N4O4/c1-3-30-22(29)19-12-13-26(24-19)18-11-7-10-17(14-18)23-20(27)15-25(2)21(28)16-8-5-4-6-9-16/h4-14H,3,15H2,1-2H3,(H,23,27) |
| InChIKey | BNDRXFILKSWGES-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |