C24H25N3O5 — CID 55711277
ethyl 1-[3-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]phenyl]pyrazole-3-carboxylate (PubChem CID 55711277) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl 1-[3-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55711277 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | ethyl 1-[3-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2cccc(NC(=O)CCC(=O)c3ccc(OCC)cc3)c2)n1 |
| InChI | InChI=1S/C24H25N3O5/c1-3-31-20-10-8-17(9-11-20)22(28)12-13-23(29)25-18-6-5-7-19(16-18)27-15-14-21(26-27)24(30)32-4-2/h5-11,14-16H,3-4,12-13H2,1-2H3,(H,25,29) |
| InChIKey | BQTOWWWINWUUCK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |