C14H18IN5 — CID 111425029
N-[(3-pyrazol-1-ylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 111425029) has the molecular formula C14H18IN5 and a molecular weight of 383.24 g/mol. Its IUPAC name is N-[(3-pyrazol-1-ylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(3-pyrazol-1-ylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 111425029 |
| Molecular Formula | C14H18IN5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[(3-pyrazol-1-ylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | I.c1cc(CNC2=NCCCN2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C14H17N5.HI/c1-4-12(11-17-14-15-6-2-7-16-14)10-13(5-1)19-9-3-8-18-19;/h1,3-5,8-10H,2,6-7,11H2,(H2,15,16,17);1H |
| InChIKey | WPMWAHPNMPQPTF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|