C16H22IN5 — CID 111912600
N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 111912600) has the molecular formula C16H22IN5 and a molecular weight of 411.29 g/mol. Its IUPAC name is N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 111912600 |
| Molecular Formula | C16H22IN5 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | I.c1ccc(CCn2ccnc2CNC2=NCCCN2)cc1 |
| InChI | InChI=1S/C16H21N5.HI/c1-2-5-14(6-3-1)7-11-21-12-10-17-15(21)13-20-16-18-8-4-9-19-16;/h1-3,5-6,10,12H,4,7-9,11,13H2,(H2,18,19,20);1H |
| InChIKey | KZSUQTYMHNDSAD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|