C14H22IN3O3 — CID 110914310
N-[(2,4,5-trimethoxyphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110914310) has the molecular formula C14H22IN3O3 and a molecular weight of 407.25 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110914310 |
| Molecular Formula | C14H22IN3O3 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | COc1cc(OC)c(OC)cc1CNC1=NCCCN1.I |
| InChI | InChI=1S/C14H21N3O3.HI/c1-18-11-8-13(20-3)12(19-2)7-10(11)9-17-14-15-5-4-6-16-14;/h7-8H,4-6,9H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | WFNLVTULAKRCOW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|