C16H23N3O2 — CID 110930326
N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 110930326) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 110930326 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=CCc1cc(CNC2=NCCCN2)cc(OC)c1OC |
| InChI | InChI=1S/C16H23N3O2/c1-4-6-13-9-12(10-14(20-2)15(13)21-3)11-19-16-17-7-5-8-18-16/h4,9-10H,1,5-8,11H2,2-3H3,(H2,17,18,19) |
| InChIKey | PUGVZSMXCRLXMQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|