C16H24IN3O2 — CID 120970748
N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120970748) has the molecular formula C16H24IN3O2 and a molecular weight of 417.29 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120970748 |
| Molecular Formula | C16H24IN3O2 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | C=CCc1cc(CNC2=NCCN2C)cc(OC)c1OC.I |
| InChI | InChI=1S/C16H23N3O2.HI/c1-5-6-13-9-12(10-14(20-3)15(13)21-4)11-18-16-17-7-8-19(16)2;/h5,9-10H,1,6-8,11H2,2-4H3,(H,17,18);1H |
| InChIKey | IOJWVKCNAVEWPU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|