C19H23NO2 — CID 126122280
N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-3-methylaniline (PubChem CID 126122280) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-3-methylaniline.
| Compound Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-3-methylaniline |
|---|---|
| PubChem CID | 126122280 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-3-methylaniline |
| SMILES | C=CCc1cc(CNc2cccc(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO2/c1-5-7-16-11-15(12-18(21-3)19(16)22-4)13-20-17-9-6-8-14(2)10-17/h5-6,8-12,20H,1,7,13H2,2-4H3 |
| InChIKey | KBMVAILCZZAHBJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|