C16H19NO2 — CID 784077
N-[(2,3-dimethoxyphenyl)methyl]-3-methylaniline (PubChem CID 784077) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-3-methylaniline.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-3-methylaniline |
|---|---|
| PubChem CID | 784077 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-3-methylaniline |
| SMILES | COc1cccc(CNc2cccc(C)c2)c1OC |
| InChI | InChI=1S/C16H19NO2/c1-12-6-4-8-14(10-12)17-11-13-7-5-9-15(18-2)16(13)19-3/h4-10,17H,11H2,1-3H3 |
| InChIKey | OIYOSGGPHPVANQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |