C17H19N5O2 — CID 78882897
N-[(2,3-dimethoxyphenyl)methyl]-3-(5-methyltetrazol-1-yl)aniline (PubChem CID 78882897) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-3-(5-methyltetrazol-1-yl)aniline.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(5-methyltetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 78882897 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(5-methyltetrazol-1-yl)aniline |
| SMILES | COc1cccc(CNc2cccc(-n3nnnc3C)c2)c1OC |
| InChI | InChI=1S/C17H19N5O2/c1-12-19-20-21-22(12)15-8-5-7-14(10-15)18-11-13-6-4-9-16(23-2)17(13)24-3/h4-10,18H,11H2,1-3H3 |
| InChIKey | BAHPFODYIHZDEH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |