C11H11N5 — CID 63951883
3-(5-methyltetrazol-1-yl)-N-prop-2-ynylaniline (PubChem CID 63951883) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-(5-methyltetrazol-1-yl)-N-prop-2-ynylaniline.
| Compound Name | 3-(5-methyltetrazol-1-yl)-N-prop-2-ynylaniline |
|---|---|
| PubChem CID | 63951883 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(5-methyltetrazol-1-yl)-N-prop-2-ynylaniline |
| SMILES | C#CCNc1cccc(-n2nnnc2C)c1 |
| InChI | InChI=1S/C11H11N5/c1-3-7-12-10-5-4-6-11(8-10)16-9(2)13-14-15-16/h1,4-6,8,12H,7H2,2H3 |
| InChIKey | IFIAUXWKFXLPIS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|