C16H21N7 — CID 78887873
N-[(1-tert-butylpyrazol-4-yl)methyl]-3-(5-methyltetrazol-1-yl)aniline (PubChem CID 78887873) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[(1-tert-butylpyrazol-4-yl)methyl]-3-(5-methyltetrazol-1-yl)aniline.
| Compound Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-3-(5-methyltetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 78887873 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-3-(5-methyltetrazol-1-yl)aniline |
| SMILES | Cc1nnnn1-c1cccc(NCc2cnn(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C16H21N7/c1-12-19-20-21-23(12)15-7-5-6-14(8-15)17-9-13-10-18-22(11-13)16(2,3)4/h5-8,10-11,17H,9H2,1-4H3 |
| InChIKey | ZXNGXFGRMVTHIM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |