C25H26BrNO2 — CID 126116734
N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-methylaniline (PubChem CID 126116734) has the molecular formula C25H26BrNO2 and a molecular weight of 452.39 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-methylaniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-methylaniline |
|---|---|
| PubChem CID | 126116734 |
| Molecular Formula | C25H26BrNO2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-methylaniline |
| SMILES | C=CCc1cc(CNc2cccc(C)c2)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H26BrNO2/c1-4-6-21-14-20(16-27-23-8-5-7-18(2)13-23)15-24(28-3)25(21)29-17-19-9-11-22(26)12-10-19/h4-5,7-15,27H,1,6,16-17H2,2-3H3 |
| InChIKey | VXEBAPKMKSWMJD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|