C25H25BrClNO2 — CID 126141196
N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-chloro-2-methylaniline (PubChem CID 126141196) has the molecular formula C25H25BrClNO2 and a molecular weight of 486.84 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-chloro-2-methylaniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-chloro-2-methylaniline |
|---|---|
| PubChem CID | 126141196 |
| Molecular Formula | C25H25BrClNO2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methyl]-3-chloro-2-methylaniline |
| SMILES | C=CCc1cc(CNc2cccc(Cl)c2C)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H25BrClNO2/c1-4-6-20-13-19(15-28-23-8-5-7-22(27)17(23)2)14-24(29-3)25(20)30-16-18-9-11-21(26)12-10-18/h4-5,7-14,28H,1,6,15-16H2,2-3H3 |
| InChIKey | QCSJPHIVMDORSL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|