C26H28BrNO2 — CID 126122526
N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline (PubChem CID 126122526) has the molecular formula C26H28BrNO2 and a molecular weight of 466.42 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126122526 |
| Molecular Formula | C26H28BrNO2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline |
| SMILES | C=CCc1cc(CNc2ccccc2C)cc(OCC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H28BrNO2/c1-4-8-22-15-21(17-28-24-10-7-6-9-19(24)3)16-25(29-5-2)26(22)30-18-20-11-13-23(27)14-12-20/h4,6-7,9-16,28H,1,5,8,17-18H2,2-3H3 |
| InChIKey | JRRSJYROKIJTFL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|