C26H26Cl3NO2 — CID 126122245
5-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline (PubChem CID 126122245) has the molecular formula C26H26Cl3NO2 and a molecular weight of 490.86 g/mol. Its IUPAC name is 5-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline.
| Compound Name | 5-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126122245 |
| Molecular Formula | C26H26Cl3NO2 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 5-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-2-methylaniline |
| SMILES | C=CCc1cc(CNc2cc(Cl)ccc2C)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl3NO2/c1-4-6-19-11-18(15-30-24-14-22(28)9-7-17(24)3)12-25(31-5-2)26(19)32-16-20-8-10-21(27)13-23(20)29/h4,7-14,30H,1,5-6,15-16H2,2-3H3 |
| InChIKey | JUPVZVQNSYXJTL-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|