C25H25ClN2O4 — CID 126121963
5-chloro-N-[[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methyl]-2-methylaniline (PubChem CID 126121963) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is 5-chloro-N-[[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methyl]-2-methylaniline.
| Compound Name | 5-chloro-N-[[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126121963 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 5-chloro-N-[[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methyl]-2-methylaniline |
| SMILES | C=CCc1cc(CNc2cc(Cl)ccc2C)cc(OC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-4-5-20-12-19(15-27-23-14-21(26)9-6-17(23)2)13-24(31-3)25(20)32-16-18-7-10-22(11-8-18)28(29)30/h4,6-14,27H,1,5,15-16H2,2-3H3 |
| InChIKey | SPORMWFBNCATMT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|