C21H27Cl3N2O2 — CID 17215530
N'-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215530) has the molecular formula C21H27Cl3N2O2 and a molecular weight of 445.82 g/mol. Its IUPAC name is N'-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215530 |
| Molecular Formula | C21H27Cl3N2O2 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N'-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1cc(Cl)c(OCc2ccc(Cl)cc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C21H27Cl3N2O2/c1-3-25-8-5-9-26-13-15-10-19(24)21(20(11-15)27-4-2)28-14-16-6-7-17(22)12-18(16)23/h6-7,10-12,25-26H,3-5,8-9,13-14H2,1-2H3 |
| InChIKey | LQMRVQIIRLLSFC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|