C23H23Cl3N2O3 — CID 66526136
N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66526136) has the molecular formula C23H23Cl3N2O3 and a molecular weight of 481.81 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66526136 |
| Molecular Formula | C23H23Cl3N2O3 |
| Molecular Weight | 481.81 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | CCOc1cc(CNCCOc2ccccn2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl3N2O3/c1-2-29-21-12-16(14-27-9-10-30-22-5-3-4-8-28-22)11-20(26)23(21)31-15-17-6-7-18(24)13-19(17)25/h3-8,11-13,27H,2,9-10,14-15H2,1H3 |
| InChIKey | ZYERQFZZCNCNFB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|