C24H25Cl2FN2O3 — CID 66526688
N-[[3-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine (PubChem CID 66526688) has the molecular formula C24H25Cl2FN2O3 and a molecular weight of 479.38 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine.
| Compound Name | N-[[3-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66526688 |
| Molecular Formula | C24H25Cl2FN2O3 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[[3-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
| SMILES | CCOc1cc(CNCCCOc2ccccn2)cc(Cl)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C24H25Cl2FN2O3/c1-2-30-22-14-17(15-28-10-6-12-31-23-9-3-4-11-29-23)13-20(26)24(22)32-16-18-19(25)7-5-8-21(18)27/h3-5,7-9,11,13-14,28H,2,6,10,12,15-16H2,1H3 |
| InChIKey | BPOVKFHSWOOBRH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|