C17H21ClN2O3 — CID 66526310
N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine (PubChem CID 66526310) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine.
| Compound Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66526310 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine |
| SMILES | COc1cc(CNCCCOc2ccccn2)cc(Cl)c1OC |
| InChI | InChI=1S/C17H21ClN2O3/c1-21-15-11-13(10-14(18)17(15)22-2)12-19-7-5-9-23-16-6-3-4-8-20-16/h3-4,6,8,10-11,19H,5,7,9,12H2,1-2H3 |
| InChIKey | WVFLKXDRJHUWOS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|