C18H23ClN2O3 — CID 66526093
N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66526093) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66526093 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | CCOc1cc(CNCCOc2ccccn2)cc(Cl)c1OCC |
| InChI | InChI=1S/C18H23ClN2O3/c1-3-22-16-12-14(11-15(19)18(16)23-4-2)13-20-9-10-24-17-7-5-6-8-21-17/h5-8,11-12,20H,3-4,9-10,13H2,1-2H3 |
| InChIKey | FHNKIVSFTWCGGV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|