C18H24N2O4 — CID 66526320
3-pyridin-2-yloxy-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine (PubChem CID 66526320) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-pyridin-2-yloxy-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-pyridin-2-yloxy-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66526320 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-pyridin-2-yloxy-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1cc(CNCCCOc2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C18H24N2O4/c1-21-15-11-14(12-16(22-2)18(15)23-3)13-19-8-6-10-24-17-7-4-5-9-20-17/h4-5,7,9,11-12,19H,6,8,10,13H2,1-3H3 |
| InChIKey | KDGNBXBGEJYPAU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|