C23H25BrN2O3 — CID 66525914
N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66525914) has the molecular formula C23H25BrN2O3 and a molecular weight of 457.37 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66525914 |
| Molecular Formula | C23H25BrN2O3 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | COc1cc(CNCCOc2ccccn2)cc(Br)c1OCc1ccccc1C |
| InChI | InChI=1S/C23H25BrN2O3/c1-17-7-3-4-8-19(17)16-29-23-20(24)13-18(14-21(23)27-2)15-25-11-12-28-22-9-5-6-10-26-22/h3-10,13-14,25H,11-12,15-16H2,1-2H3 |
| InChIKey | JXDVQOQAXTXLBW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|