C22H22BrClN2O3 — CID 66535984
N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66535984) has the molecular formula C22H22BrClN2O3 and a molecular weight of 477.79 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66535984 |
| Molecular Formula | C22H22BrClN2O3 |
| Molecular Weight | 477.79 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | COc1ccc(Br)c(CNCCOc2ccccn2)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H22BrClN2O3/c1-27-20-10-9-18(23)17(14-25-12-13-28-21-8-4-5-11-26-21)22(20)29-15-16-6-2-3-7-19(16)24/h2-11,25H,12-15H2,1H3 |
| InChIKey | NBBCSBMRUGEOCF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|