C22H22BrFN2O3 — CID 66535800
N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66535800) has the molecular formula C22H22BrFN2O3 and a molecular weight of 461.33 g/mol. Its IUPAC name is N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66535800 |
| Molecular Formula | C22H22BrFN2O3 |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-[[6-bromo-2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | COc1ccc(Br)c(CNCCOc2ccccn2)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22BrFN2O3/c1-27-20-10-9-19(23)18(14-25-12-13-28-21-4-2-3-11-26-21)22(20)29-15-16-5-7-17(24)8-6-16/h2-11,25H,12-15H2,1H3 |
| InChIKey | FYUYMRLFGRROTN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|