C19H25BrN2O3 — CID 66526249
N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine (PubChem CID 66526249) has the molecular formula C19H25BrN2O3 and a molecular weight of 409.32 g/mol. Its IUPAC name is N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine.
| Compound Name | N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66526249 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]-3-pyridin-2-yloxypropan-1-amine |
| SMILES | CCCOc1c(CNCCCOc2ccccn2)cc(Br)cc1OC |
| InChI | InChI=1S/C19H25BrN2O3/c1-3-10-25-19-15(12-16(20)13-17(19)23-2)14-21-8-6-11-24-18-7-4-5-9-22-18/h4-5,7,9,12-13,21H,3,6,8,10-11,14H2,1-2H3 |
| InChIKey | IMHCFYWGVLLTTK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|