C14H20BrNO2 — CID 29228094
N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]prop-2-en-1-amine (PubChem CID 29228094) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 29228094 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[(5-bromo-3-methoxy-2-propoxyphenyl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cc(Br)cc(OC)c1OCCC |
| InChI | InChI=1S/C14H20BrNO2/c1-4-6-16-10-11-8-12(15)9-13(17-3)14(11)18-7-5-2/h4,8-9,16H,1,5-7,10H2,2-3H3 |
| InChIKey | FXUVRURLBTVRKC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|