C21H29BrClNO3 — CID 17209150
N-[(5-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine;hydrochloride (PubChem CID 17209150) has the molecular formula C21H29BrClNO3 and a molecular weight of 458.82 g/mol. Its IUPAC name is N-[(5-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine;hydrochloride.
| Compound Name | N-[(5-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17209150 |
| Molecular Formula | C21H29BrClNO3 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-[(5-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine;hydrochloride |
| SMILES | COc1cc(Br)cc(CNCCCOC(C)C)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C21H28BrNO3.ClH/c1-16(2)25-11-7-10-23-14-18-12-19(22)13-20(24-3)21(18)26-15-17-8-5-4-6-9-17;/h4-6,8-9,12-13,16,23H,7,10-11,14-15H2,1-3H3;1H |
| InChIKey | HWXXCXPMCKEQIO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|