C21H27Cl2NO3 — CID 4716416
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine (PubChem CID 4716416) has the molecular formula C21H27Cl2NO3 and a molecular weight of 412.36 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 4716416 |
| Molecular Formula | C21H27Cl2NO3 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1cc(Cl)c(OCc2ccccc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C21H27Cl2NO3/c1-3-25-11-7-10-24-14-16-12-19(23)21(20(13-16)26-4-2)27-15-17-8-5-6-9-18(17)22/h5-6,8-9,12-13,24H,3-4,7,10-11,14-15H2,1-2H3 |
| InChIKey | ZULOBRNXOUEWDZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|