C21H29Cl2NO3 — CID 17206139
N-[[2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17206139) has the molecular formula C21H29Cl2NO3 and a molecular weight of 414.37 g/mol. Its IUPAC name is N-[[2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17206139 |
| Molecular Formula | C21H29Cl2NO3 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[[2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1cccc(OCC)c1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C21H28ClNO3.ClH/c1-3-24-14-8-13-23-15-17-10-7-12-20(25-4-2)21(17)26-16-18-9-5-6-11-19(18)22;/h5-7,9-12,23H,3-4,8,13-16H2,1-2H3;1H |
| InChIKey | LUNRGRROPIKGOP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|